The 1H-Imidazole,2-(4-chlorophenyl)-, with the CAS registry number 4205-05-4, is also known as 2-(4-Chloro-phenyl)-1H-imidazole. This chemical's molecular formula is C₉H₇ClN₂ and molecular weight is 178.62. Its systematic name is called 2-(4-chlorophenyl)-1H-imidazole.

Physical properties of 1H-Imidazole,2-(4-chlorophenyl)-: (1)ACD/LogP: 2.28; (2)ACD/LogD (pH 5.5): 1.28; (3)ACD/LogD (pH 7.4): 2.23; (4)ACD/BCF (pH 5.5): 3.17; (5)ACD/BCF (pH 7.4): 28.27; (6)ACD/KOC (pH 5.5): 41.31; (7)ACD/KOC (pH 7.4): 368.91; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.615; (12)Molar Refractivity: 48.26 cm³; (13)Molar Volume: 138.2 cm³; (14)Surface Tension: 51.4 dyne/cm; (15)Density: 1.292 g/cm³; (16)Flash Point: 206.3 °C; (17)Enthalpy of Vaporization: 58.77 kJ/mol; (18)Boiling Point: 365.5 °C at 760 mmHg; (19)Vapour Pressure: 3.29E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc2ccc(c1nccn1)cc2
(2)InChI: InChI=1/C9H7ClN2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-6H,(H,11,12)
(3)InChIKey: HJCFDCKEUGZLPS-UHFFFAOYAS