The 2,4-Dibromonitrobenzene, with the CAS registry number 51686-78-3, has the IUPAC name 2,4-dibromo-1-nitrobenzene. Its molecular formula is C₆H₃Br₂NO₂ and its molecular weight is 280.901520. Additionally, it's also 2,4-Dibromonitrobenzene.

The characteristics of 2,4-Dibromonitrobenzene are as followings: (1)ACD/LogP: 3.61; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 128; (6)ACD/BCF (pH 7.4): 128; (7)ACD/KOC (pH 5.5): 1122; (8)ACD/KOC (pH 7.4): 1122; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 45.82 Ų; (13)Index of Refraction: 1.64; (14)Molar Refractivity: 48.179 cm³; (15)Molar Volume: 133.645 cm³; (16)Polarizability: 19.1×10^-24cm³; (17)Surface Tension: 54.878 dyne/cm; (18)Density: 2.102 g/cm³; (19)Flash Point: 117.353 °C; (20)Enthalpy of Vaporization: 48.813 kJ/mol; (21)Boiling Point: 270.431 °C at 760 mmHg; (22)Vapour Pressure: 0.011 mmHg at 25°C.  

You can still convert the following datas into molecular structure:
(1)SMILES: O=N(=O)c1ccc(Br)cc1Br
(2)InChI: InChI=1/C6H3Br2NO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H
(3)InChIKey: DXRVYZGVVFZCFP-UHFFFAOYAS