The Phenol, 2,5-bis(trifluoromethyl)- has the CAS registry number 779-88-4. This chemical's molecular formula is C₈H₄F₆O and molecular weight is 230.11. What's more, its systematic name is 2,5-bis(trifluoromethyl)phenol.

Physical properties of Phenol, 2,5-bis(trifluoromethyl)- are: (1)ACD/LogP: 4.61; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 1; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 9.23 Å²; (7)Index of Refraction: 1.406; (8)Molar Refractivity: 38.09 cm³; (9)Molar Volume: 154.8 cm³; (10)Polarizability: 15.1×10^-24cm³; (11)Surface Tension: 22.3 dyne/cm; (12)Density: 1.485 g/cm³; (13)Flash Point: 65.8 °C; (14)Enthalpy of Vaporization: 43.87 kJ/mol; (15)Boiling Point: 185.2 °C at 760 mmHg; (16)Vapour Pressure: 0.515 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: FC(F)(F)c1ccc(cc1O)C(F)(F)F
(2)InChI: InChI=1/C8H4F6O/c9-7(10,11)4-1-2-5(6(15)3-4)8(12,13)14/h1-3,15H
(3)InChIKey: OJOPQGWFLQVKDU-UHFFFAOYAN