The 2-Amino-1,5-naphthalenedisulfonic acid with CAS registry number of 117-62-4 is also known as 2-Naphthylamine-1,5-disulfonic acid. The IUPAC name is 2-Aminonaphthalene-1,5-disulfonic acid. It belongs to product categories of Intermediates of Dyes and Pigments; Organic acids. Its EINECS registry number is 204-201-6. In addition, the formula is C₁₀H₉NO₆S₂ and the molecular weight is 303.31. This chemical is a beige powder. Besides, it is used as dye intermediate.

Physical properties about 2-Amino-1,5-naphthalenedisulfonic acid are: (1)ACD/LogP: -0.43; (2)ACD/LogD (pH 5.5): -4.93; (3)ACD/LogD (pH 7.4): -4.93; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 7; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.733; (12)Molar Refractivity: 68.62 cm³; (13)Molar Volume: 171.3 cm³; (14)Surface Tension: 90.1 dyne/cm; (15)Density: 1.769 g/cm³.

When you are using this chemical, please be cautious about it. As a chemical, it is irritating to eyes and can cause burns. If contact with eyes accidently, rinse immediately with plenty of water and seek medical advice.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: C1=CC2=C(C=CC(=C2S(=O)(=O)O)N)C(=C1)S(=O)(=O)O
2. InChI: InChI=1S/C10H9NO6S2/c11-8-5-4-6-7(10(8)19(15,16)17)2-1-3-9(6)18(12,13)14/h1-5H,11H2,(H,12,13,14)(H,15,16,17)
3. InChIKey: YAIKCRUPEVOINQ-UHFFFAOYSA-N

The toxicity data is as follows: