The 2-Naphthalenesulfonicacid, 1,4-dihydro-1,4-dioxo-, potassium salt (1:1) with CAS registry number of 34169-62-5 is also known as 1,4-Naphthoquinone-2-sulphonicacid potassium salt. The IUPAC name is Potassium 1,4-dioxonaphthalene-2-sulfonate. Its EINECS registry number is 251-861-6. In addition, the formula is C₁₀H₆O₅S.K and the molecular weight is 277.31.

Physical properties about 2-Naphthalenesulfonicacid, 1,4-dihydro-1,4-dioxo-, potassium salt (1:1) are: (1)ACD/LogP: 0.99; (2)ACD/LogD (pH 5.5): -2.51; (3)ACD/LogD (pH 7.4): -2.51; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 5; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 96.89Ų.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: C1=CC=C2C(=C1)C(=O)C=C(C2=O)S(=O)(=O)[O-].[K+]
2. InChI: InChI=1S/C10H6O5S.K/c11-8-5-9(16(13,14)15)10(12)7-4-2-1-3-6(7)8;/h1-5H,(H,13,14,15);/q;+1/p-1
3. InChIKey: WZEGLRXCWYMIDO-UHFFFAOYSA-M