The 2-Pyridinemethanol,5-(1-pyrrolidinyl)-, with the CAS registry number 930110-98-8, is also known as 2-(Hydroxymethyl)-5-(pyrrolidin-1-yl)pyridine 97%. This chemical's molecular formula is C₁₀H₁₄N₂O and molecular weight is 178.231. Its systematic name is called (5-pyrrolidin-1-yl-2-pyridyl)methanol.

Physical properties of 2-Pyridinemethanol,5-(1-pyrrolidinyl)-: (1)ACD/LogP: 0.31; (2)ACD/LogD (pH 7.4): 0.3; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 3; (6)Index of Refraction: 1.59; (7)Molar Refractivity: 51 cm³; (8)Molar Volume: 151 cm³; (9)Surface Tension: 55.1 dyne/cm; (10)Density: 1.18 g/cm³; (11)Flash Point: 169.3 °C; (12)Enthalpy of Vaporization: 63.48 kJ/mol; (13)Boiling Point: 356.3 °C at 760 mmHg; (14)Vapour Pressure: 1.07E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(ncc1N2CCCC2)CO
(2)InChI: InChI=1/C10H14N2O/c13-8-9-3-4-10(7-11-9)12-5-1-2-6-12/h3-4,7,13H,1-2,5-6,8H2
(3)InChIKey: GLWULQJNDPJFDR-UHFFFAOYAD