The 3-Amino-6-chloro-2-picoline is an organic compound with the formula C₆H₇ClN₂. The IUPAC name of this chemical is 6-chloro-2-methylpyridin-3-amine. With the CAS registry number 164666-68-6, it is also named as 3-Pyridinamine, 6-chloro-2-methyl-. The product's categories are Pyridine; Halide; Pyridine Series; Pyridines; Boronic Acid; Amino-pyridine Series.

The other characteristics of 3-Amino-6-chloro-2-picoline can be summarized as: (1)ACD/LogP: 1.34; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.34; (4)ACD/LogD (pH 7.4): 1.34; (5)ACD/BCF (pH 5.5): 6.1; (6)ACD/BCF (pH 7.4): 6.11; (7)ACD/KOC (pH 5.5): 127.02; (8)ACD/KOC (pH 7.4): 127.12; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 16.13 Å²; (13)Index of Refraction: 1.592; (14)Molar Refractivity: 38.3 cm³; (15)Molar Volume: 113.1 cm³; (16)Polarizability: 15.18×10^-24 cm³; (17)Surface Tension: 49.9 dyne/cm; (18)Enthalpy of Vaporization: 52.5 kJ/mol; (19)Vapour Pressure: 0.00272 mmHg at 25°C; (20)Exact Mass: 142.029776; (21)MonoIsotopic Mass: 142.029776; (22)Topological Polar Surface Area: 38.9; (23)Heavy Atom Count: 9; (24)Complexity: 97.1.

People can use the following data to convert to the molecule structure. 
1. SMILES:Clc1nc(c(N)cc1)C
2. InChI:InChI=1/C6H7ClN2/c1-4-5(8)2-3-6(7)9-4/h2-3H,8H2,1H3
3. InChIKey:QVCIIOZINFCMDJ-UHFFFAOYAN
4. Std. InChI:InChI=1S/C6H7ClN2/c1-4-5(8)2-3-6(7)9-4/h2-3H,8H2,1H3
5. Std. InChIKey:QVCIIOZINFCMDJ-UHFFFAOYSA-N