The Benzenecarboximidamide,4-chloro-, with the CAS registry number 19563-04-3, is also known as 4-Chloro-benzamidine hydrochloride, 95%. This chemical's molecular formula is C₇H₇ClN₂ and molecular weight is 154.5969. Its systematic name is called 4-chlorobenzenecarboximidamide.

Physical properties of Benzenecarboximidamide,4-chloro-: (1)ACD/LogP: 1.41; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1.4; (5)ACD/KOC (pH 7.4): 1.43; (6)#H bond acceptors: 2; (7)#H bond donors: 3; (8)#Freely Rotating Bonds: 1; (9)Index of Refraction: 1.597; (10)Molar Refractivity: 40.68 cm³; (11)Molar Volume: 119.3 cm³; (12)Surface Tension: 47.2 dyne/cm; (13)Density: 1.29 g/cm³; (14)Flash Point: 99.6 °C; (15)Enthalpy of Vaporization: 47.8 kJ/mol; (16)Boiling Point: 241.1 °C at 760 mmHg; (17)Vapour Pressure: 0.0366 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1ccc(C(=[N@H])N)cc1
(2)InChI: InChI=1/C7H7ClN2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H3,9,10)
(3)InChIKey: LFCUMSZYMJRUHD-UHFFFAOYAE