The CAS registry number of 5-Pyrimidinecarboxamide,3,4-dihydro-4-oxo- is 4786-53-2. This chemical is also known as 4-Hydroxypyrimidine-5-carboxamide. The molecular formula of it is C₅H₅N₃O₂ and molecular weight is 139.1121. Its systematic name is called 6-oxo-1,6-dihydropyrimidine-5-carboxamide.

Physical properties about this chemical are: (1)ACD/LogP: -2.66; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 5; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.696; (11)Molar Refractivity: 32.76 cm³; (12)Molar Volume: 85.1 cm³; (13)Surface Tension: 75.1 dyne/cm; (14)Density: 1.63 g/cm³; (15)Flash Point: 191.6 °C; (16)Enthalpy of Vaporization: 66.81 kJ/mol; (17)Boiling Point: 393.1 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(\C1=C\N=C/NC1=O)N
(2)InChI: InChI=1/C5H5N3O2/c6-4(9)3-1-7-2-8-5(3)10/h1-2H,(H2,6,9)(H,7,8,10)
(3)InChIKey: ZOSXLRUOBVSFQV-UHFFFAOYAZ