The CAS registry number of 6-(4-Fluorophenyl)pyridine-3-boronic is 1072944-20-7. This chemical is also known as 6-(4-Fluorophenyl)pyridine-3-boronic acid pinacol ester. The molecular formula of it is C₁₇H₁₉BFNO₂ and molecular weight is 299.1477. Its systematic name is called 2-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.

Physical properties about this chemical are: (1)#H bond acceptors: 3; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 2; (4)Index of Refraction: 1.539; (5)Molar Refractivity: 82.07 cm³; (6)Molar Volume: 261.8 cm³; (7)Surface Tension: 39.5 dyne/cm; (8)Density: 1.14 g/cm³; (9)Flash Point: 197.2 °C; (10)Enthalpy of Vaporization: 62.82 kJ/mol; (11)Boiling Point: 402.5 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: CC1(C)OB(OC1(C)C)c2ccc(nc2)c3ccc(F)cc3
(2)InChI: InChI=1/C17H19BFNO2/c1-16(2)17(3,4)22-18(21-16)13-7-10-15(20-11-13)12-5-8-14(19)9-6-12/h5-11H,1-4H3
(3)InChIKey: CTCLIEHCPOJNSW-UHFFFAOYAZ