The CAS registry number of 6-(Fluoromethyl)-2-methyl-1H-pyrimidin-4-one is 3110-42-7. This chemical is also known as 4-Pyrimidinol, 6-(fluoromethyl)-2-methyl- (6CI,8CI). The molecular formula of it is C₆H₇FN₂O and molecular weight is 142.131. Its systematic name is called 6-(fluoromethyl)-2-methylpyrimidin-4(1H)-one.

Physical properties about this chemical are: (1)ACD/LogP: -0.23; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 1; (6)Index of Refraction: 1.54; (7)Molar Refractivity: 34.28 cm³; (8)Molar Volume: 109.1 cm³; (9)Surface Tension: 36.8 dyne/cm; (10)Density: 1.3 g/cm³; (11)Flash Point: 83.5 °C; (12)Enthalpy of Vaporization: 45.07 kJ/mol; (13)Boiling Point: 214.4 °C at 760 mmHg; (14)Vapour Pressure: 0.156 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: FCC=1N\C(=N/C(=O)C=1)C
(2)InChI: InChI=1/C6H7FN2O/c1-4-8-5(3-7)2-6(10)9-4/h2H,3H2,1H3,(H,8,9,10)
(3)InChIKey: BFOODGFSIMOOBW-UHFFFAOYAW