The CAS registry number of 6-Chloro-N-heptyl-1,3,5-triazine-2,4-diamine is 6642-22-4. Its molecular formula is C₁₀H₁₈ClN₅ and molecular weight is 243.7364. Its systematic name is called 6-chloro-N-heptyl-1,3,5-triazine-2,4-diamine.

Physical properties about 6-Chloro-N-heptyl-1,3,5-triazine-2,4-diamine are: (1)ACD/LogP: 3.81; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 3; (5)#Freely Rotating Bonds: 6; (6)Index of Refraction: 1.578; (7)Molar Refractivity: 67.06 cm³; (8)Molar Volume: 201.8 cm³; (9)Surface Tension: 54.7 dyne/cm; (10)Density: 1.207 g/cm³; (11)Flash Point: 213.3 °C; (12)Enthalpy of Vaporization: 68.43 kJ/mol; (13)Boiling Point: 429.1 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1nc(nc(n1)NCCCCCCC)N
(2)InChI: InChI=1/C10H18ClN5/c1-2-3-4-5-6-7-13-10-15-8(11)14-9(12)16-10/h2-7H2,1H3,(H3,12,13,14,15,16)
(3)InChIKey: BKDHMBVCFDTRLX-UHFFFAOYAO