The 9-Eicosenedioic acid,(9Z)-, with the CAS registry number 253687-69-3, is also known as (9Z)-Icos-9-enedioic acid. This chemical's molecular formula is C₂₀H₃₆O₄ and molecular weight is 340.50. What's more, its systematic name is (Z)-Icos-9-enedioic acid. Its classification code is: TSCA Flag P [A commenced PMN (Premanufacture Notice) substance].

Physical properties of 9-Eicosenedioic acid,(9Z)- are: (1)ACD/LogP: 6.66; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.06; (4)ACD/LogD (pH 7.4): 2.04; (5)ACD/BCF (pH 5.5): 1719.43; (6)ACD/BCF (pH 7.4): 1.63; (7)ACD/KOC (pH 5.5): 2537.79; (8)ACD/KOC (pH 7.4): 2.41; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 18; (12)Polar Surface Area: 74.6 Å²; (13)Index of Refraction: 1.485; (14)Molar Refractivity: 97.89 cm³; (15)Molar Volume: 341.5 cm³; (16)Polarizability: 38.8×10^-24 cm³; (17)Surface Tension: 39.9 dyne/cm; (18)Density: 0.996 g/cm³; (19)Flash Point: 257.1 °C; (20)Enthalpy of Vaporization: 81.3 kJ/mol; (21)Boiling Point: 478.2 °C at 760 mmHg; (22)Vapour Pressure: 1.85E-10 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1)SMILES: C(CCCC/C=C\CCCCCCCC(=O)O)CCCCC(=O)O
(2)InChI: InChI=1/C20H36O4/c21-19(22)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(23)24/h1,3H,2,4-18H2,(H,21,22)(H,23,24)/b3-1-
(3)InChIKey: NZLFRLCYQVOISV-IWQZZHSRBY