The 9H-Fluoren-9-one, 2,7-dichloro-4-nitro- has the CAS registry number 37568-11-9. This chemical's molecular formula is C₁₃H₅Cl₂NO₃ and molecular weight is 294.09. What's more, its systematic name is 2,7-dichloro-4-nitro-9H-fluoren-9-one.

Physical properties of 9H-Fluoren-9-one, 2,7-dichloro-4-nitro- are: (1)ACD/LogP: 4.69; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 62.89 Å²; (7)Index of Refraction: 1.706; (8)Molar Refractivity: 70.26 cm³; (9)Molar Volume: 180.5 cm³; (10)Polarizability: 27.85×10^-24cm³; (11)Surface Tension: 69.2 dyne/cm; (12)Density: 1.628 g/cm³; (13)Flash Point: 250.2 °C; (14)Enthalpy of Vaporization: 75.66 kJ/mol; (15)Boiling Point: 490.2 °C at 760 mmHg; (16)Vapour Pressure: 9.36E-10 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [O-][N+](=O)c3c2c1ccc(Cl)cc1C(=O)c2cc(Cl)c3
(2)InChI: InChI=1S/C13H5Cl2NO3/c14-6-1-2-8-9(3-6)13(17)10-4-7(15)5-11(12(8)10)16(18)19/h1-5H
(3)InChIKey: VLUDOGGJLGZHSC-UHFFFAOYSA-N