The Acetamide, 2-chloro-N-(2, 3, 5, 6-tetrachlorophenyl)-, with the CAS registry number of 121806-76-6, is also known as ZINC03379361. This chemical's molecular formula is C₈H₄Cl₅NO and molecular weight is 307.388460. What's more, its IUPAC name is 2-Chloro-N-(2, 3, 5, 6-tetrachlorophenyl)acetamide.

Physical properties about Acetamide, 2-chloro-N-(2, 3, 5, 6-tetrachlorophenyl)- are: (1)ACD/LogP: 3.10; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.1; (4)ACD/LogD (pH 7.4): 3.1; (5)ACD/BCF (pH 5.5): 133.58; (6)ACD/BCF (pH 7.4): 132.91; (7)ACD/KOC (pH 5.5): 1156.65; (8)ACD/KOC (pH 7.4): 1150.91; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 20.31 Å²; (13)Index of Refraction: 1.633; (14)Molar Refractivity: 64.95 cm³; (15)Molar Volume: 181.7 cm³; (16)Surface Tension: 54.1 dyne/cm; (17)Density: 1.691 g/cm³; (18)Flash Point: 205.2 °C; (19)Enthalpy of Vaporization: 66.89 kJ/mol; (20)Boiling Point: 415.8 °C at 760 mmHg; (21)Vapour Pressure: 4.02E-07 mmHg at 25 °C.

Preparation of Acetamide, 2-chloro-N-(2, 3, 5, 6-tetrachlorophenyl)-: this chemical is prepared by reaction of Chloroacetyl chloride with 2, 3, 5, 6-Tetrachloro-aniline by heating. The reaction needs solvent Toluene. The reaction time is 3 hours. The yield is about 61 %.

You can still convert the following datas into molecular structure:
(1) SMILES: Clc1c(NC(=O)CCl)c(Cl)c(Cl)cc1Cl
(2) InChI: InChI=1/C8H4Cl5NO/c9-2-5(15)14-8-6(12)3(10)1-4(11)7(8)13/h1H,2H2,(H,14,15)
(3) InChIKey: JKLYTUFJGMKSTB-UHFFFAOYAO