The Anhydrous aluminum silicate, with the CAS registry number 22708-90-3, is also known as Dialuminum disiloxane-1,1,1,3,3,3-hexolate. This chemical's molecular formula is Al₂O₇Si₂ and molecular weight is 222.1299. What's more, its IUPAC name is dialuminum trioxido(trioxidosilyloxy)silane.

Physical properties about this chemical are: (1)ACD/LogP: 2.18; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 2.18; (4)ACD/LogD (pH 7.4): 2.18; (5)ACD/BCF (pH 5.5): 26.6; (6)ACD/BCF (pH 7.4): 26.6; (7)#H bond acceptors: 7; (8)#H bond donors: 6; (9)#Freely Rotating Bonds: 8; (10)Polar Surface Area: 130.61 Å².

You can still convert the following datas into molecular structure:
(1) SMILES: [Al+3].[Al+3].[O-][Si]([O-])([O-])O[Si]([O-])([O-])[O-]
(2) InChI: InChI=1/2Al.O7Si2/c;;1-8(2,3)7-9(4,5)6/q2*+3;-6
(3) InChIKey: RUYJNKYXOHIGPH-UHFFFAOYAI