The Benzenemethanol,3-(2-furanyl)-, with the CAS registry number 89929-93-1, is also known as [3-(2-Furyl)phenyl]methanol 97%. This chemical's molecular formula is C₁₁H₁₀O₂ and molecular weight is 174.1959. Its IUPAC name is called (3-furan-2-ylphenyl)methanol.

Physical properties of Benzenemethanol,3-(2-furanyl)-: (1)ACD/LogP: 2.68; (2)ACD/LogD (pH 5.5): 2; (3)ACD/LogD (pH 7.4): 2; (4)ACD/BCF (pH 5.5): 19; (5)ACD/BCF (pH 7.4): 19; (6)ACD/KOC (pH 5.5): 286; (7)ACD/KOC (pH 7.4): 286; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.569; (12)Molar Refractivity: 49.596 cm³; (13)Molar Volume: 151.329 cm³; (14)Surface Tension: 43.283 dyne/cm; (15)Density: 1.151 g/cm³; (16)Flash Point: 137.75 °C; (17)Enthalpy of Vaporization: 57.496 kJ/mol; (18)Boiling Point: 304.158 °C at 760 mmHg; (19)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: OCc1cccc(c1)c2occc2
(2)InChI: InChI=1/C11H10O2/c12-8-9-3-1-4-10(7-9)11-5-2-6-13-11/h1-7,12H,8H2
(3)InChIKey: SBTRFADZILHXNG-UHFFFAOYAR