The CAS registry number of Benzenesulfonamide,3-amino-4,5-dimethyl- is 101251-33-6. This chemical is also named as 3,4-Xylenesulfonamide,5-amino-(6CI). In addition, its molecular formula is C₈H₁₂N₂O₂S and molecular weight is 200.261. Its systematic name and IUPAC name are the same which is called 3-amino-4,5-dimethylbenzenesulfonamide.

Physical properties about Benzenesulfonamide,3-amino-4,5-dimethyl- are: (1)ACD/LogP: -0.28; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 16.72; (6)ACD/KOC (pH 7.4): 16.77; (7)#H bond acceptors: 4; (8)#H bond donors: 4; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.594; (11)Molar Refractivity: 52.05 cm³; (12)Molar Volume: 153.2 cm³; (13)Surface Tension: 55.1 dyne/cm; (14)Density: 1.307 g/cm³; (15)Flash Point: 214 °C; (16)Enthalpy of Vaporization: 68.58 kJ/mol; (17)Boiling Point: 430.3 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=S(=O)(c1cc(N)c(c(c1)C)C)N
(2)InChI: InChI=1/C8H12N2O2S/c1-5-3-7(13(10,11)12)4-8(9)6(5)2/h3-4H,9H2,1-2H3,(H2,10,11,12)
(3)InChIKey: YXQMLWCILAYJQY-UHFFFAOYAH