The Benzoicacid, 3,5-dibromo-2,6-dinitro- has the CAS registry number 67973-19-7. This chemical's molecular formula is C₇H₂Br₂N₂O₆ and molecular weight is 369.91. What's more, its systematic name is 3,5-Dibromo-2,6-dinitrobenzoic acid.

Physical properties of Benzoicacid, 3,5-dibromo-2,6-dinitro- are: (1)ACD/LogP: 3.28; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 8; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 128.94 Å²; (11)Index of Refraction: 1.709; (12)Molar Refractivity: 61.654 cm³; (13)Molar Volume: 158.016 cm³; (14)Polarizability: 24.442×10^-24 cm³; (15)Surface Tension: 86.114 dyne/cm; (16)Density: 2.341 g/cm³; (17)Flash Point: 190.165 °C; (18)Enthalpy of Vaporization: 67.538 kJ/mol; (19)Boiling Point: 390.825 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=[N+]([O-])c1c(c(c(Br)cc1Br)[N+]([O-])=O)C(O)=O
(2)InChI: InChI=1/C7H2Br2N2O6/c8-2-1-3(9)6(11(16)17)4(7(12)13)5(2)10(14)15/h1H,(H,12,13)
(3)InChIKey: IKKZZHCFXNBGAB-UHFFFAOYSA-N