The Butanedioic acid,2-decyl-, with the CAS registry number 2530-33-8, is also known as 2-Decylsuccinic acid. Its EINECS registry number is 219-783-7. This chemical's molecular formula is C₁₄H₂₆O₄ and molecular weight is 258.35. What's more, both its IUPAC name and systematic name are the same which is called 2-Decylbutanedioic acid.

Physical properties about this chemical are: (1)ACD/LogP: 4.54; (2)#of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 0.01; (5)ACD/BCF (pH 5.5): 48.09; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 203.57; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 12; (12)Polar Surface Area: 52.6 Å²; (13)Index of Refraction: 1.473; (14)Molar Refractivity: 69.99 cm³; (15)Molar Volume: 249.2 cm³; (16)Polarizability: 27.74×10^-24cm³; (17)Surface Tension: 40.8 dyne/cm; (18)Density: 1.036 g/cm³; (19)Flash Point: 193.2 °C; (20)Enthalpy of Vaporization: 68.04 kJ/mol; (21)Boiling Point: 372.4 °C at 760 mmHg; (22)Vapour Pressure: 1.43E-06 mmHg at 25 °C.

Preparation of Butanedioic acid,2-decyl: this chemical can be prepared by Decylsuccinic acid anhydride. This reaction needs reagent NaOH.

Uses of Butanedioic acid,2-decyl: it is used to produce other chemicals. For example, it is used to produce 2-Decyl-butanedioyl dichloride. The reaction occurs with reagent PCl₅ at ambient temperature. The yield is 100 %.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C(O)CC(C(=O)O)CCCCCCCCCC
(2) InChI: InChI=1/C14H26O4/c1-2-3-4-5-6-7-8-9-10-12(14(17)18)11-13(15)16/h12H,2-11H2,1H3,(H,15,16)(H,17,18)
(3) InChIKey: WSFYPFLCEFLXOZ-UHFFFAOYAD