10012-73-4 Usage
Uses
1. Used in Pharmaceutical Industry:
Stemmadenine is used as a pharmaceutical compound for its potential therapeutic applications. The expression is: stemmadenine is used as a pharmaceutical compound for its potential therapeutic applications.
2. Used in Research and Development:
Stemmadenine is used as a research compound for studying its chemical properties, structural characteristics, and potential interactions with other molecules. The expression is: stemmadenine is used as a research compound for studying its chemical properties, structural characteristics, and potential interactions with other molecules.
3. Used in Drug Discovery:
Stemmadenine may be used as a starting point for drug discovery, particularly in the development of new therapeutic agents. The expression is: stemmadenine is used as a starting point for drug discovery, particularly in the development of new therapeutic agents.
4. Used in Chemical Synthesis:
Stemmadenine can be used as a building block or intermediate in the synthesis of other complex organic compounds. The expression is: stemmadenine is used as a building block or intermediate in the synthesis of other complex organic compounds.
5. Used in Analytical Chemistry:
Stemmadenine's unique spectral properties make it potentially useful in analytical chemistry for the development of new methods or techniques. The expression is: stemmadenine is used in analytical chemistry for the development of new methods or techniques.
References
Watts, Collera, Sandoval., Tetrahedron, 2, 173 (1958)
Stauffacher., HeZv. Chim. Acta, 44, 2006 (1961)
Sandoval et aZ., Tetrahedron Lett., 409 (1962)
Schumann, Schmid., HeZv. Chim. Acta., 46, 1996 (1963)
Linde., ibid, 48,1822 (1965)
Check Digit Verification of cas no
The CAS Registry Mumber 10012-73-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,1 and 2 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10012-73:
(7*1)+(6*0)+(5*0)+(4*1)+(3*2)+(2*7)+(1*3)=34
34 % 10 = 4
So 10012-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C21H26N2O3/c1-3-14-12-23-10-8-15(14)19(21(25)26-13-24)20-17(9-11-23)16-6-4-5-7-18(16)22(20)2/h3-7,15,19,24H,8-13H2,1-2H3/b14-3+