1003707-72-9 Usage
Uses
Used in Pharmaceutical Industry:
3-Acetylamino-2-fluorobenzyl alcohol is used as a key intermediate in the synthesis of new drugs, particularly in medicinal chemistry. Its incorporation into drug molecules can enhance their pharmacological properties, such as potency, selectivity, and bioavailability, making it a crucial component in the development of innovative therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Acetylamino-2-fluorobenzyl alcohol is utilized as a building block for the creation of novel agrochemicals. Its unique structure can contribute to the development of more effective and environmentally friendly pesticides, herbicides, and other agricultural chemicals.
Used as a Reagent in Organic Synthesis:
3-Acetylamino-2-fluorobenzyl alcohol also serves as a versatile reagent in various chemical reactions. Its presence can facilitate the synthesis of complex organic compounds, making it an indispensable tool for chemists working in the field of organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 1003707-72-9 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,0,3,7,0 and 7 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1003707-72:
(9*1)+(8*0)+(7*0)+(6*3)+(5*7)+(4*0)+(3*7)+(2*7)+(1*2)=99
99 % 10 = 9
So 1003707-72-9 is a valid CAS Registry Number.
InChI:InChI=1S/C9H10FNO2/c1-6(13)11-8-4-2-3-7(5-12)9(8)10/h2-4,12H,5H2,1H3,(H,11,13)
