1005-88-5 Usage
Uses
Used in Pharmaceutical and Agrochemical Synthesis:
3-AMINO-5-ETHYL-5-METHYL-IMIDAZOLIDINE-2,4-DIONE is used as a building block for the synthesis of pharmaceuticals and agrochemicals due to its unique chemical structure, which allows for the creation of a diverse range of compounds with potential therapeutic and agricultural applications.
Used in Research and Development:
In the research industry, 3-AMINO-5-ETHYL-5-METHYL-IMIDAZOLIDINE-2,4-DIONE is used as a key component in the development of new materials and as a catalyst in chemical reactions. Its unique properties make it a valuable asset in advancing scientific understanding and creating innovative products.
Used in Material Development:
3-AMINO-5-ETHYL-5-METHYL-IMIDAZOLIDINE-2,4-DIONE is utilized in the development of new materials, where its chemical structure and properties contribute to the creation of novel substances with potential applications in various industries.
Used in Biological and Pharmacological Studies:
3-AMINO-5-ETHYL-5-METHYL-IMIDAZOLIDINE-2,4-DIONE is used in biological and pharmacological research for its potential anti-inflammatory and antioxidant effects. These properties make it a promising candidate for further study and potential development as a therapeutic agent.
Overall, 3-AMINO-5-ETHYL-5-METHYL-IMIDAZOLIDINE-2,4-DIONE's diverse applications across various industries highlight its importance and potential in the fields of chemistry, biology, and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 1005-88-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,0 and 5 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1005-88:
(6*1)+(5*0)+(4*0)+(3*5)+(2*8)+(1*8)=45
45 % 10 = 5
So 1005-88-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H11N3O2/c1-3-6(2)4(10)9(7)5(11)8-6/h3,7H2,1-2H3,(H,8,11)/t6-/m1/s1
