102294-97-3 Usage
Uses
Used in Pharmaceutical Synthesis:
1-(4-IODOBENZYL)-4-METHYLPIPERAZINE is utilized as a key intermediate in the synthesis of various pharmaceuticals due to its ability to be incorporated into complex molecular structures. Its presence in the molecular framework can influence the pharmacological properties of the resulting compounds, making it a valuable component in drug development.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 1-(4-IODOBENZYL)-4-METHYLPIPERAZINE is employed as a reagent for the preparation of bioactive molecules. Its unique structural features allow for the exploration of new chemical spaces and the discovery of potential therapeutic agents with novel mechanisms of action.
Used in Organic Synthesis:
1-(4-IODOBENZYL)-4-METHYLPIPERAZINE is also used as a reagent in organic synthesis for the preparation of complex organic molecules. Its iodobenzyl moiety can participate in various chemical reactions, facilitating the construction of intricate molecular architectures that are important in the synthesis of specialty chemicals and materials.
Used in Chemical Product Development:
As an intermediate in the production of drugs and other chemical products, 1-(4-IODOBENZYL)-4-METHYLPIPERAZINE plays a crucial role in the development of new chemical entities. Its versatility and reactivity make it a sought-after component in the creation of innovative products across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 102294-97-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,2,9 and 4 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 102294-97:
(8*1)+(7*0)+(6*2)+(5*2)+(4*9)+(3*4)+(2*9)+(1*7)=103
103 % 10 = 3
So 102294-97-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H17IN2/c1-14-6-8-15(9-7-14)10-11-2-4-12(13)5-3-11/h2-5H,6-10H2,1H3
102294-97-3Relevant articles and documents
ALKYNYL PHOSPHINE GOLD COMPLEXES FOR TREATING BACTERIAL INFECTIONS
-
Page/Page column 85, (2017/08/01)
A compound of formula (I) for use in the prevention or treatment of a bacterial infection.
Gas-phase nucleophilic aromatic substitution between piperazine and halobenzyl cations: Reactivity of the methylene arenium form of benzyl cations
Chai, Yunfeng,Jiang, Kezhi,Sun, Cuirong,Pan, Yuanjiang
body text, p. 10820 - 10824 (2011/11/07)
Methylene arenium involved in SNAr: The gas-phase nucleophilic aromatic substitution reactions of halobenzyl cations with piperazine through a cationic σ complex were studied using ESI mass spectrometry. This study demonstrates that the methylene arenium form of halobenzyl cations exhibits nucleophilic substitution reactivity at the phenyl ring (see scheme). Copyright
