103038-66-0 Usage
Uses
Used in Pharmaceutical Industry:
3-CHLORO-N-(2-CHLOROBENZYL)PROPANAMIDE is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure, including the presence of chlorine and benzyl groups, may provide specific properties that are beneficial in the development of new drugs.
Used in Chemical Synthesis:
In the chemical industry, 3-CHLORO-N-(2-CHLOROBENZYL)PROPANAMIDE can be used as a building block or reactant in the synthesis of more complex organic molecules. Its functional groups may allow for further reactions and modifications, leading to the creation of new compounds with desired properties.
Used in Research and Development:
3-CHLORO-N-(2-CHLOROBENZYL)PROPANAMIDE may also be utilized in research and development settings to study its chemical properties, reactivity, and potential interactions with other compounds. This can help in understanding its behavior and exploring new applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 103038-66-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,0,3 and 8 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 103038-66:
(8*1)+(7*0)+(6*3)+(5*0)+(4*3)+(3*8)+(2*6)+(1*6)=80
80 % 10 = 0
So 103038-66-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11Cl2NO/c11-6-5-10(14)13-7-8-3-1-2-4-9(8)12/h1-4H,5-7H2,(H,13,14)
