103213-31-6 Usage
Uses
Used in Biochemistry and Organic Synthesis:
FMOC-3,5-DIIODO-L-TYROSINE is used as a reagent in peptide synthesis for its ability to facilitate the formation of peptide bonds and its role as a halogenated building block in organic synthesis. Its distinct chemical properties make it a versatile compound in the laboratory setting.
Used in Pharmaceutical Research and Development:
In the pharmaceutical industry, FMOC-3,5-DIIODO-L-TYROSINE is utilized as a key component in the development of new drugs and therapeutic agents. Its unique structure and reactivity contribute to the design and synthesis of novel pharmaceutical compounds with potential applications in various medical fields.
Used in Medicinal Chemistry:
FMOC-3,5-DIIODO-L-TYROSINE serves as a valuable tool in medicinal chemistry for the synthesis of bioactive molecules and the modification of existing drugs to improve their efficacy, selectivity, and pharmacokinetic properties. Its presence in the synthesis process can lead to the development of more effective treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 103213-31-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,2,1 and 3 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 103213-31:
(8*1)+(7*0)+(6*3)+(5*2)+(4*1)+(3*3)+(2*3)+(1*1)=56
56 % 10 = 6
So 103213-31-6 is a valid CAS Registry Number.
InChI:InChI=1/C24H19I2NO5/c25-19-9-13(10-20(26)22(19)28)11-21(23(29)30)27-24(31)32-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-10,18,21,28H,11-12H2,(H,27,31)(H,29,30)/t21-/m0/s1