103796-52-7 Usage
Uses
Used in Pharmaceutical Industry:
4-ETHOXY-3-METHOXYPHENYLACETONITRILE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and properties make it a valuable component in the development of new drugs and medications.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 4-ETHOXY-3-METHOXYPHENYLACETONITRILE is utilized as a key intermediate in the synthesis of a wide range of organic compounds. Its versatility and reactivity contribute to the creation of diverse chemical entities with potential applications in various industries.
Used in Drug Development:
4-ETHOXY-3-METHOXYPHENYLACETONITRILE is employed as a building block in drug development, facilitating the design and synthesis of novel therapeutic agents. Its presence in the molecular structure of certain drugs can impart specific pharmacological properties, enhancing their efficacy and safety.
Used in Fine Chemicals Production:
4-ETHOXY-3-METHOXYPHENYLACETONITRILE is also used in the production of fine chemicals, which are high-purity chemicals with specialized applications in various industries, such as agriculture, fragrances, and dyes. The aromatic nature of 4-ETHOXY-3-METHOXYPHENYLACETONITRILE makes it suitable for the synthesis of these high-value chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 103796-52-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,7,9 and 6 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 103796-52:
(8*1)+(7*0)+(6*3)+(5*7)+(4*9)+(3*6)+(2*5)+(1*2)=127
127 % 10 = 7
So 103796-52-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO2/c1-3-14-10-5-4-9(6-7-12)8-11(10)13-2/h4-5,8H,3,6H2,1-2H3
