1046788-78-6 Usage
Uses
Used in Pharmaceutical Synthesis:
(2R,5S)-1,2,5-Trimethylpiperazine is utilized as a key building block in the synthesis of pharmaceuticals, contributing to the development of new drugs. Its ability to chelate metal ions plays a crucial role in enhancing the efficacy and stability of certain medications.
Used in Agrochemical Production:
In the agrochemical industry, (2R,5S)-1,2,5-Trimethylpiperazine serves as an essential component in the creation of various agrochemicals. Its chelating properties can improve the performance and environmental compatibility of these compounds, making them more effective in agricultural applications.
Used in Industrial Applications:
(2R,5S)-1,2,5-Trimethylpiperazine is employed in various industrial applications due to its ability to bind with metal ions. This feature can be leveraged in processes that require the removal or stabilization of metal ions, such as in water treatment or metal finishing.
Used in Medical Research:
(2R,5S)-1,2,5-Trimethylpiperazine has been investigated for its potential biological activity, showing promise as a drug candidate for the treatment of certain diseases. Its unique stereochemistry and chelating capabilities make it a valuable subject for ongoing research in medicinal chemistry and therapeutic development.
Check Digit Verification of cas no
The CAS Registry Mumber 1046788-78-6 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,4,6,7,8 and 8 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1046788-78:
(9*1)+(8*0)+(7*4)+(6*6)+(5*7)+(4*8)+(3*8)+(2*7)+(1*8)=186
186 % 10 = 6
So 1046788-78-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H16N2/c1-6-5-9(3)7(2)4-8-6/h6-8H,4-5H2,1-3H3/t6-,7+/m0/s1
