106864-38-4 Usage
Uses
Used in Organic Synthesis:
2,4-dimethoxybenzhydrylamine is utilized as a reactant in organic synthesis for the creation of other organic compounds. Its unique structure allows it to participate in various chemical reactions, making it a valuable component in the synthesis of a wide range of products.
Used in Pharmaceutical Research:
2,4-dimethoxybenzhydrylamine is studied for its potential pharmacological properties, indicating its use as a precursor in the development of new drugs. Its ability to interact with biological systems and modulate specific pathways makes it a promising candidate for pharmaceutical applications.
Used as a Chemical Intermediate in Pharmaceutical Production:
In the pharmaceutical industry, 2,4-dimethoxybenzhydrylamine is employed as a chemical intermediate for the production of various products. Its involvement in the synthesis of active pharmaceutical ingredients highlights its importance in the development of new medications.
Used as a Chemical Intermediate in Dye and Fragrance Production:
2,4-dimethoxybenzhydrylamine also serves as a chemical intermediate in the production of dyes and fragrances. Its unique chemical structure allows it to contribute to the color and scent profiles of these products, making it an essential component in their manufacturing processes.
Check Digit Verification of cas no
The CAS Registry Mumber 106864-38-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,8,6 and 4 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 106864-38:
(8*1)+(7*0)+(6*6)+(5*8)+(4*6)+(3*4)+(2*3)+(1*8)=134
134 % 10 = 4
So 106864-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO2/c1-17-12-8-9-13(14(10-12)18-2)15(16)11-6-4-3-5-7-11/h3-10,15H,16H2,1-2H3
