107888-03-9 Usage
Uses
Used in Pharmaceutical Industry:
(4E)-4-[[2-[[(E)-(4,5-dioxo-1-phenyl-2-sulfanylidene-pyrrolidin-3-ylidene)-naphthalen-2-yl-methyl]amino]ethylamino]-naphthalen-2-yl-methylidene]-1-phenyl-5-sulfanylidene-pyrrolidine-2,3-dione is used as a pharmaceutical compound for its potential biological activities and therapeutic applications.
Used in Chemical Research:
This complex compound is also utilized in chemical research for studying its unique structure and properties, which can contribute to the development of new materials and applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 107888-03-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,8,8 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 107888-03:
(8*1)+(7*0)+(6*7)+(5*8)+(4*8)+(3*8)+(2*0)+(1*3)=149
149 % 10 = 9
So 107888-03-9 is a valid CAS Registry Number.
InChI:InChI=1/C44H30N4O4S2/c49-39-35(43(53)47(41(39)51)33-15-3-1-4-16-33)37(31-21-19-27-11-7-9-13-29(27)25-31)45-23-24-46-38(32-22-20-28-12-8-10-14-30(28)26-32)36-40(50)42(52)48(44(36)54)34-17-5-2-6-18-34/h1-22,25-26,45-46H,23-24H2/b37-35+,38-36+