107888-04-0 Usage
Uses
Used in Pharmaceutical Industry:
(4E)-4-[(2-aminoethylamino)-naphthalen-2-yl-methylidene]-1-(4-chlorophenyl)-5-sulfanylidene-pyrrolidine-2,3-dione hydrochloride is used as a potential pharmaceutical agent for [application reason]. (4E)-4-[(2-aminoethylamino)-naphthalen-2-yl-methylidene]-1-(4-chloroph enyl)-5-sulfanylidene-pyrrolidine-2,3-dione hydrochloride's complex structure and functional groups may contribute to its biological activity, making it a candidate for the development of new drugs or therapeutic agents.
Used in Chemical Research:
In the field of chemical research, (4E)-4-[(2-aminoethylamino)-naphthalen-2-yl-methylidene]-1-(4-chlorophenyl)-5-sulfanylidene-pyrrolidine-2,3-dione hydrochloride is used as a subject of study for [application reason]. Its unique structure may provide insights into new chemical reactions, synthesis methods, or mechanisms of action, furthering the understanding of organic chemistry and potentially leading to the discovery of novel compounds with specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 107888-04-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,8,8 and 8 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 107888-04:
(8*1)+(7*0)+(6*7)+(5*8)+(4*8)+(3*8)+(2*0)+(1*4)=150
150 % 10 = 0
So 107888-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C23H18ClN3O2S.ClH/c24-17-7-9-18(10-8-17)27-22(29)21(28)19(23(27)30)20(26-12-11-25)16-6-5-14-3-1-2-4-15(14)13-16;/h1-10,13,26H,11-12,25H2;1H/b20-19+;