110295-93-7 Usage
Uses
Used in Pharmaceutical Industry:
(2-AMINO-THIAZOL-5-YL)-ACETIC ACID METHYL ESTER is used as a building block for the synthesis of various pharmaceutical compounds due to its unique chemical structure and reactivity. Its presence in the molecule allows for the formation of new chemical entities with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, (2-AMINO-THIAZOL-5-YL)-ACETIC ACID METHYL ESTER serves as a valuable intermediate for the development of new organic compounds. Its unique structure and functional groups make it a versatile component in the synthesis of novel molecules with potential applications in various industries.
Used in Agrochemical Industry:
(2-AMINO-THIAZOL-5-YL)-ACETIC ACID METHYL ESTER is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique chemical properties allow for the development of new compounds with improved efficacy and selectivity in controlling pests and weeds.
Used in Material Science:
In material science, (2-AMINO-THIAZOL-5-YL)-ACETIC ACID METHYL ESTER can be used as a component in the development of new materials with specific properties. Its incorporation into polymers or other materials can lead to the creation of materials with enhanced properties, such as improved stability, reactivity, or selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 110295-93-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,2,9 and 5 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 110295-93:
(8*1)+(7*1)+(6*0)+(5*2)+(4*9)+(3*5)+(2*9)+(1*3)=97
97 % 10 = 7
So 110295-93-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O2S/c1-10-5(9)2-4-3-8-6(7)11-4/h3H,2H2,1H3,(H2,7,8)