110525-56-9 Usage
Uses
Used in Pharmaceutical Industry:
4-(1H-pyrazol-1-yl)butanoic acid (SALTDATA: FREE) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows for the creation of diverse molecules with potential therapeutic effects.
Used in Biochemical Research:
In the field of biochemical research, 4-(1H-pyrazol-1-yl)butanoic acid (SALTDATA: FREE) serves as a valuable building block for the development of new biochemical agents. Its incorporation into complex molecules can lead to the discovery of novel biochemical pathways and mechanisms.
Used in Drug Discovery:
4-(1H-pyrazol-1-yl)butanoic acid (SALTDATA: FREE) is utilized in drug discovery processes to identify potential therapeutic agents. Its pyrazole and butanoic acid groups provide a foundation for the design of molecules with specific biological activities, which can be further optimized for medical applications.
Used in Medicinal Chemistry:
In medicinal chemistry, 4-(1H-pyrazol-1-yl)butanoic acid (SALTDATA: FREE) is employed as a key component in the synthesis of new drug candidates. Its structural features enable the development of molecules with improved pharmacokinetic and pharmacodynamic properties, enhancing their potential as therapeutic agents.
While the specific applications and reasons for using 4-(1H-pyrazol-1-yl)butanoic acid (SALTDATA: FREE) in various industries are not explicitly detailed in the provided materials, the general uses listed above are inferred from its role as a building block in pharmaceutical and biochemical applications and its potential for therapeutic properties. Further research is necessary to fully understand its capabilities and optimize its use in medical and scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 110525-56-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,5,2 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 110525-56:
(8*1)+(7*1)+(6*0)+(5*5)+(4*2)+(3*5)+(2*5)+(1*6)=79
79 % 10 = 9
So 110525-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O2/c10-7(11)3-1-5-9-6-2-4-8-9/h2,4,6H,1,3,5H2,(H,10,11)
110525-56-9Relevant articles and documents
Novel Parham-type Cycloacylations of 1H-Pyrazole-1-alkanoic Acids
Larsen, Scott D.
, p. 1013 - 1014 (2007/10/03)
Exposure of 1H-pyrazole-1-alkanoic acids to two equivalents of n-butyllithium affords the corresponding cyclic ketones via a Parham-type cyclization process. Although yields are modest, this procedure represents a simple and direct intramolecular acylation of a non-nucleophilic pyrazole carbon.
