112710-37-9 Usage
Uses
Used in Pharmaceutical Industry:
(2S)-2-(3-aminopropanoylamino)-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid is used as a pharmaceutical compound for its potential therapeutic applications. The presence of the amino acid and phenyl group, along with the chlorine-substituted ethyl groups, may contribute to its interaction with biological targets, such as enzymes or receptors, making it a candidate for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, (2S)-2-(3-aminopropanoylamino)-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid serves as a subject for studying the synthesis and properties of complex organic molecules. Its unique structure allows researchers to explore various chemical reactions and investigate its potential applications in different areas of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 112710-37-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,7,1 and 0 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 112710-37:
(8*1)+(7*1)+(6*2)+(5*7)+(4*1)+(3*0)+(2*3)+(1*7)=79
79 % 10 = 9
So 112710-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H23Cl2N3O3/c17-6-9-21(10-7-18)13-3-1-12(2-4-13)11-14(16(23)24)20-15(22)5-8-19/h1-4,14H,5-11,19H2,(H,20,22)(H,23,24)/t14-/m0/s1