1160923-98-7 Usage
Uses
Used in Pharmaceutical Industry:
5-Bromo-4-chloronicotinonitrile is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with improved efficacy and reduced side effects. It plays a crucial role in the production of medications for the treatment of various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical industry, 5-Bromo-4-chloronicotinonitrile is utilized as an intermediate in the synthesis of various agrochemicals, including pesticides and herbicides. Its incorporation into these products helps to improve their effectiveness in controlling pests and weeds, thereby increasing crop yields and ensuring food security.
Used in Organic Chemistry Research:
5-Bromo-4-chloronicotinonitrile is used as a building block in organic chemistry research for the creation of heterocyclic compounds. Its unique structure allows for the development of novel compounds with potential applications in various fields, such as medicine, materials science, and dyes.
Used in Material Science:
5-Bromo-4-chloronicotinonitrile has been studied for its potential use in the development of new materials. Its unique properties make it a promising candidate for the creation of advanced materials with improved performance characteristics, such as enhanced stability, durability, and functionality.
Used in Dye Industry:
In the dye industry, 5-Bromo-4-chloronicotinonitrile has been explored for its potential use in the development of new dyes. Its unique structure and properties can contribute to the creation of dyes with improved colorfastness, brightness, and resistance to fading, making them suitable for various applications, including textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 1160923-98-7 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,6,0,9,2 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1160923-98:
(9*1)+(8*1)+(7*6)+(6*0)+(5*9)+(4*2)+(3*3)+(2*9)+(1*8)=147
147 % 10 = 7
So 1160923-98-7 is a valid CAS Registry Number.
InChI:InChI=1S/C6H2BrClN2/c7-5-3-10-2-4(1-9)6(5)8/h2-3H
1160923-98-7Relevant articles and documents
5-ALKYL/ALKENYL-3-CYANOPYRIDINES AS KINASE INHIBITORS
-
Page/Page column 117, (2009/07/17)
Described herein are compounds of formula I: wherein G is and pharmaceutically acceptable salts thereof, wherein J, X, R1, R2, R11, R12' and p are as defined herein. Also provided herein are methods of making the compounds of formula I, and methods of using these compounds for inhibiting or treating a pathological condition or disorder linked to or mediated by a protein kinase in a mammal.
