120102-97-8 Usage
Uses
Used in Organic Synthesis:
[4-(4-pentanoylphenyl)diazenylphenyl] propanoate is used as a reagent in organic synthesis for its ability to participate in a variety of chemical reactions, contributing to the formation of complex molecular structures.
Used in Chemical Research:
In the field of chemical research, [4-(4-pentanoylphenyl)diazenylphenyl] propanoate is employed as an intermediate, playing a significant role in the development and understanding of new chemical compounds and reactions.
Used in Pharmaceutical Industry:
[4-(4-pentanoylphenyl)diazenylphenyl] propanoate is used as a potential candidate in the pharmaceutical industry due to its unique chemical properties, which may contribute to the development of new drugs and therapeutic agents.
Used in Dyes:
[4-(4-pentanoylphenyl)diazenylphenyl] propanoate is also used in the dye industry, where its chemical structure and properties can be harnessed to create new and innovative dye formulations.
Used in Other Industrial Products:
[4-(4-pentanoylphenyl)diazenylphenyl] propanoate's potential applications extend to other industrial products, where its unique properties can be utilized to enhance or create new products in various sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 120102-97-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,1,0 and 2 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 120102-97:
(8*1)+(7*2)+(6*0)+(5*1)+(4*0)+(3*2)+(2*9)+(1*7)=58
58 % 10 = 8
So 120102-97-8 is a valid CAS Registry Number.
InChI:InChI=1/C20H22N2O3/c1-3-5-6-19(23)15-7-9-16(10-8-15)21-22-17-11-13-18(14-12-17)25-20(24)4-2/h7-14H,3-6H2,1-2H3/b22-21+