120720-70-9 Usage
Uses
Used in Pharmaceutical Research:
1H-Benzimidazole,1-(fluoromethyl)-2-methyl-(9CI) is used as a key intermediate in the synthesis of various pharmaceutical drugs. Its unique chemical structure and properties enable the development of novel therapeutic agents with improved efficacy and selectivity.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1H-Benzimidazole,1-(fluoromethyl)-2-methyl-(9CI) serves as a building block for the design and synthesis of new drug candidates. Its versatile chemical reactivity allows for the introduction of various functional groups, enabling the exploration of different chemical space and the discovery of innovative therapeutic agents.
Used in Drug Discovery:
1H-Benzimidazole,1-(fluoromethyl)-2-methyl-(9CI) is employed as a starting material in drug discovery programs. Its potential pharmacological and biological activities make it a valuable tool for the identification of new lead compounds and the optimization of drug candidates for the treatment of various diseases.
Used in Organic Synthesis:
In organic synthesis, 1H-Benzimidazole,1-(fluoromethyl)-2-methyl-(9CI) is utilized as a versatile reagent and precursor for the preparation of a wide range of organic compounds. Its unique structural features and reactivity contribute to the synthesis of complex organic molecules and the development of novel synthetic methodologies.
Overall, 1H-Benzimidazole,1-(fluoromethyl)-2-methyl-(9CI) is a valuable chemical entity with significant applications in various fields, particularly in the development of pharmaceutical drugs and the advancement of organic synthesis techniques. Its diverse uses in medicinal chemistry and drug discovery highlight its potential as a promising compound for future research and therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 120720-70-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,7,2 and 0 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 120720-70:
(8*1)+(7*2)+(6*0)+(5*7)+(4*2)+(3*0)+(2*7)+(1*0)=79
79 % 10 = 9
So 120720-70-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H9FN2/c1-7-11-8-4-2-3-5-9(8)12(7)6-10/h2-5H,6H2,1H3
