123333-86-8 Usage
Uses
Used in Organic Synthesis:
TOLUENE-3,4-DITHIOL ZINC SALT HYDRATE is used as a catalyst in various organic transformations for its ability to facilitate reactions and improve the yield of desired products.
Used in Pharmaceutical Industry:
TOLUENE-3,4-DITHIOL ZINC SALT HYDRATE is used as a precursor in the synthesis of pharmaceutical ingredients due to its reactivity and potential to form new compounds with therapeutic properties.
Used in Material Science:
TOLUENE-3,4-DITHIOL ZINC SALT HYDRATE is used as a component in the production of functional materials, leveraging its chemical properties to create materials with specific characteristics for various applications.
Used in Chemical Research:
TOLUENE-3,4-DITHIOL ZINC SALT HYDRATE is used as a reagent in chemical research to explore new reaction pathways and develop innovative synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 123333-86-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,3,3 and 3 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 123333-86:
(8*1)+(7*2)+(6*3)+(5*3)+(4*3)+(3*3)+(2*8)+(1*6)=98
98 % 10 = 8
So 123333-86-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H8S2.H2O.Zn/c1-5-2-3-6(8)7(9)4-5;;/h2-4,8-9H,1H3;1H2;/q;;+2/p-2/rC7H6S2Zn.H2O/c1-5-2-3-6-7(4-5)9-10-8-6;/h2-4H,1H3;1H2
