123427-18-9 Usage
Chemical compound
A substance with a specific molecular structure formed by the combination of atoms in a fixed proportion.
Complex molecular structure
The compound has a complex arrangement of atoms, including pyrimidine and morpholine rings.
Pyrimidine ring
A six-membered heterocyclic aromatic ring with four carbon atoms and two nitrogen atoms.
Morpholine ring
A six-membered heterocyclic ring containing two oxygen atoms and four carbon atoms.
Dithiol compound
Contains two thiol (sulfhydryl) functional groups, which are characterized by a sulfur-hydrogen bond (-SH).
Organic synthesis
The compound has potential applications in the creation of new organic compounds through chemical reactions.
Materials science
The unique structural properties and reactivity of the compound make it potentially useful in the development of new materials.
Biological activity
The compound may have biological activity, making it of interest for pharmaceutical research.
Industrial applications
Due to its complex and potentially versatile molecular structure, the compound may have potential uses in the development of new materials and compounds for various industries.
Reactivity
The presence of thiol functional groups suggests that the compound may be reactive with other molecules, allowing for the formation of new chemical bonds and the creation of new compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 123427-18-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,4,2 and 7 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 123427-18:
(8*1)+(7*2)+(6*3)+(5*4)+(4*2)+(3*7)+(2*1)+(1*8)=99
99 % 10 = 9
So 123427-18-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H30N6O2S2/c1-16-14-18(24-20(22-16)26-4-8-28-9-5-26)30-12-3-13-31-19-15-17(2)23-21(25-19)27-6-10-29-11-7-27/h14-15H,3-13H2,1-2H3