123562-49-2 Usage
Uses
Used in Pharmaceutical Industry:
(1R)-8β-[6-O-[(E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propenyl]-β-D-glucopyranosyloxy]-4,4aβ,8,8aβ-tetrahydro-1β-methyl-3-oxo-1H,3H-pyrano[3,4-c]pyran-5-carboxylic acid is used as a potential pharmaceutical agent for its possible biological activity. Given its complex structure and the presence of functional groups that may interact with biological systems, it could be further explored for medicinal applications, such as the development of new drugs or therapies.
Used in Research and Development:
In the field of organic chemistry and natural product research, this compound serves as a subject of study for understanding its synthesis, structure, and potential interactions with biological targets. It may also be used as a starting point for the development of new chemical entities with specific therapeutic effects.
Check Digit Verification of cas no
The CAS Registry Mumber 123562-49-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,5,6 and 2 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 123562-49:
(8*1)+(7*2)+(6*3)+(5*5)+(4*6)+(3*2)+(2*4)+(1*9)=112
112 % 10 = 2
So 123562-49-2 is a valid CAS Registry Number.
InChI:InChI=1/C25H28O14/c1-10-19-12(7-18(29)37-10)13(23(33)34)8-36-24(19)39-25-22(32)21(31)20(30)16(38-25)9-35-17(28)5-3-11-2-4-14(26)15(27)6-11/h2-6,8,10,12,16,19-22,24-27,30-32H,7,9H2,1H3,(H,33,34)/b5-3+/t10-,12-,16-,19-,20-,21+,22-,24+,25+/m1/s1