125509-89-9 Usage
Aziridine-containing amino acid derivative
This compound belongs to a class of molecules that contain an aziridine ring and an amino acid derivative, which may contribute to its potential pharmaceutical and biological activities.
Potential pharmaceutical and biological activities
Due to its unique structure and composition, 2-(4-amino-4-carboxybutyl)-2-aziridinecarboxylic acid may exhibit biological activities that could be useful in the development of drugs and therapeutic agents.
Precursor for the synthesis of other biologically active molecules
This compound may serve as a starting material for the synthesis of other molecules with biological activity, making it a valuable intermediate in medicinal chemistry and drug development.
Reactivity with biological molecules
The chemical structure of 2-(4-amino-4-carboxybutyl)-2-aziridinecarboxylic acid suggests that it may interact with other biological molecules, which could be relevant for its potential pharmacological properties.
Potential pharmacological properties
The compound's structure and composition may endow it with properties that could be exploited for therapeutic purposes, such as modulating biological processes or targeting specific receptors.
Further research opportunities
The properties and potential uses of 2-(4-amino-4-carboxybutyl)-2-aziridinecarboxylic acid are not yet fully understood, and further research could provide valuable insights for the development of new drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 125509-89-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,5,5,0 and 9 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 125509-89:
(8*1)+(7*2)+(6*5)+(5*5)+(4*0)+(3*9)+(2*8)+(1*9)=129
129 % 10 = 9
So 125509-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N2O4/c9-5(6(11)12)2-1-3-8(4-10-8)7(13)14/h5,10H,1-4,9H2,(H,11,12)(H,13,14)
