126826-79-7 Usage
Uses
Used in Organic Synthesis:
(1-Methyl-2-piperidinylidene)thiourea is used as a reagent in organic synthesis for its ability to facilitate various chemical reactions, contributing to the formation of desired products.
Used in Pharmaceutical Industry:
(1-Methyl-2-piperidinylidene)thiourea is used as a precursor in the development of pharmaceutical compounds due to its potential biological activity and ability to form complexes with metal ions.
Used as a Catalyst in Organic Reactions:
(1-Methyl-2-piperidinylidene)thiourea serves as a catalyst to enhance the rate of certain organic reactions, improving the efficiency and selectivity of the processes.
Used as a Chelating Agent in Analytical Chemistry:
(1-Methyl-2-piperidinylidene)thiourea is used as a chelating agent in analytical chemistry to bind metal ions, which aids in the detection, analysis, and separation of metal species.
Used in Environmental Remediation:
The ability of (1-Methyl-2-piperidinylidene)thiourea to form complexes with metal ions has led to research into its use for environmental remediation, particularly in the sequestration and removal of heavy metals from contaminated sites.
Check Digit Verification of cas no
The CAS Registry Mumber 126826-79-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,8,2 and 6 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 126826-79:
(8*1)+(7*2)+(6*6)+(5*8)+(4*2)+(3*6)+(2*7)+(1*9)=147
147 % 10 = 7
So 126826-79-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H13N3S/c1-10-5-3-2-4-6(10)9-7(8)11/h2-5H2,1H3,(H2,8,11)/b9-6+
