127227-40-1 Usage
Uses
Used in Pharmaceutical Industry:
(5E)-3-[5-[2-[(4-chlorophenyl)amino]acetyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(1H-indol-3-ylmethylidene)-2-methyl-imidazol-4-one is used as a potential pharmaceutical candidate for various applications due to its complex structure and the presence of multiple functional groups. (5E)-3-[5-[2-[(4-chlorophenyl)amino]acetyl]sulfanyl-1,3,4-thiadiazol-2 -yl]-5-(1H-indol-3-ylmethylidene)-2-methyl-imidazol-4-one's diverse structural elements may allow it to interact with a wide range of biological targets, making it a promising candidate for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, (5E)-3-[5-[2-[(4-chlorophenyl)amino]acetyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(1H-indol-3-ylmethylidene)-2-methyl-imidazol-4-one can be used as a starting material or a model compound for studying the properties and reactivity of thiadiazole, imidazolone, and indole rings. Its complex structure may also provide insights into the design and synthesis of new compounds with specific chemical and biological activities.
Used in Material Science:
(5E)-3-[5-[2-[(4-chlorophenyl)amino]acetyl]sulfanyl-1,3,4-thiadiazol-2 -yl]-5-(1H-indol-3-ylmethylidene)-2-methyl-imidazol-4-one's unique structural features may also find applications in material science, where it could be explored for its potential to influence the properties of various materials. For instance, its incorporation into polymers or other materials could lead to new materials with enhanced or novel characteristics, such as improved stability, conductivity, or responsiveness to external stimuli.
Check Digit Verification of cas no
The CAS Registry Mumber 127227-40-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,2,2 and 7 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 127227-40:
(8*1)+(7*2)+(6*7)+(5*2)+(4*2)+(3*7)+(2*4)+(1*0)=111
111 % 10 = 1
So 127227-40-1 is a valid CAS Registry Number.
InChI:InChI=1/C23H17ClN6O2S2/c1-13-27-19(10-14-11-26-18-5-3-2-4-17(14)18)21(32)30(13)22-28-29-23(34-22)33-20(31)12-25-16-8-6-15(24)7-9-16/h2-11,25-26H,12H2,1H3/b19-10+