136062-62-9 Usage
Uses
Used in Chemical Research:
3-Amino-3-(4-Methylpiperazino)acrylonitrile is used as a research compound for exploring its chemical properties and potential applications in various fields. Its unique molecular structure makes it a subject of interest for scientists studying organic chemistry and related disciplines.
Used in Pharmaceutical Development:
3-Amino-3-(4-Methylpiperazino)acrylonitrile is used as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its reactivity and the presence of functional groups, such as the carbon-carbon double bond and the nitrile group, make it a valuable component in the development of new drugs.
Used in Industrial Applications:
3-Amino-3-(4-Methylpiperazino)acrylonitrile is used as a specialty chemical in various industrial processes. Its specific applications may include the production of polymers, dyes, or other chemical products, where its unique properties can be exploited to achieve desired outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 136062-62-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,0,6 and 2 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 136062-62:
(8*1)+(7*3)+(6*6)+(5*0)+(4*6)+(3*2)+(2*6)+(1*2)=109
109 % 10 = 9
So 136062-62-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N4/c1-11-4-6-12(7-5-11)8(10)2-3-9/h2H,4-7,10H2,1H3/b8-2+
136062-62-9Relevant articles and documents
Synthesis of 2-amino-5-pyrimidinecarbonitrile derivatives
Cocco,Congiu,Onnis,Maccioni
, p. 529 - 530 (2007/10/02)
2-Amino-4-dialkylamino- or -4-ethoxy-6-methylthio-5-pyrimidine-carbonitriles 3 are obtained through a base-induced reaction between 3-amino-3-(dialkylamino)propenenitriles 1 and N-[bis(methylthio)methylene]cyanamide (2).
