136379-59-4 Usage
Uses
Used in Pharmaceutical Applications:
2-[[(5R,6R,7S,9S,11R,18R,19S)-19-amino-6-(3,4-dicarboxybutanoyloxy)-11,18-dihydroxy-5,9-dimethyl-icosan-7-yl]oxycarbonylmethyl]butanedioic acid is used as a pharmaceutical compound for its potential therapeutic effects. Its complex structure and functional groups may allow it to interact with biological targets and modulate various biological pathways.
Used in Biochemical Research:
2-[[(5R,6R,7S,9S,11R,18R,19S)-19-amino-6-(3,4-dicarboxybutanoyloxy)-11,18-dihydroxy-5,9-dimethyl-icosan-7-yl]oxycarbonylmethyl]butanedioic acid is used as a biochemical research tool to study the interactions between complex molecules and biological systems. Its synthesis and properties may provide insights into the development of new drugs and therapies.
Used in Organic Chemistry:
2-[[(5R,6R,7S,9S,11R,18R,19S)-19-amino-6-(3,4-dicarboxybutanoyloxy)-11,18-dihydroxy-5,9-dimethyl-icosan-7-yl]oxycarbonylmethyl]butanedioic acid is used in organic chemistry as a complex molecule with unique structural features. Its synthesis and properties may be of interest to researchers studying the synthesis and reactivity of complex organic molecules.
Used in Chemical Biology:
2-[[(5R,6R,7S,9S,11R,18R,19S)-19-amino-6-(3,4-dicarboxybutanoyloxy)-11,18-dihydroxy-5,9-dimethyl-icosan-7-yl]oxycarbonylmethyl]butanedioic acid is used in chemical biology to explore the interactions between complex molecules and biological systems. Its unique structure and functional groups may provide insights into the development of new bioactive compounds and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 136379-59-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,3,7 and 9 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 136379-59:
(8*1)+(7*3)+(6*6)+(5*3)+(4*7)+(3*9)+(2*5)+(1*9)=154
154 % 10 = 4
So 136379-59-4 is a valid CAS Registry Number.
InChI:InChI=1/C34H59NO14/c1-5-6-11-21(3)32(49-31(43)19-24(34(46)47)17-29(40)41)27(48-30(42)18-23(33(44)45)16-28(38)39)15-20(2)14-25(36)12-9-7-8-10-13-26(37)22(4)35/h20-27,32,36-37H,5-19,35H2,1-4H3,(H,38,39)(H,40,41)(H,44,45)(H,46,47)/t20-,21+,22-,23?,24?,25+,26+,27-,32+/m0/s1