136605-16-8 Usage
Uses
Used in Organic Synthesis:
(BENZOTRIAZOL-1-YLOXY)DIPIPERIDINOCARBENIUM TETRAFLUOROBORATE is used as a catalyst for facilitating various chemical reactions, especially those involving carbon-carbon bond formation. Its role in organic synthesis is crucial for the production of a multitude of chemical compounds.
Used in Pharmaceutical Manufacturing:
In the pharmaceutical industry, (BENZOTRIAZOL-1-YLOXY)DIPIPERIDINOCARBENIUM TETRAFLUOROBORATE is used as a catalyst for the synthesis of various pharmaceutical compounds. Its ability to facilitate complex chemical reactions makes it a valuable tool in the development of new drugs and medicines.
Used in Agrochemical Production:
(BENZOTRIAZOL-1-YLOXY)DIPIPERIDINOCARBENIUM TETRAFLUOROBORATE is also utilized in the agrochemical industry, where it serves as a catalyst for the synthesis of various agrochemical products. Its application in this field contributes to the development of effective and efficient agricultural chemicals.
Used in Polymer and Coating Production:
As a stabilizer, (BENZOTRIAZOL-1-YLOXY)DIPIPERIDINOCARBENIUM TETRAFLUOROBORATE is used in the production of polymers and coatings. Its stabilizing properties help improve the quality and durability of these materials, making it an essential component in the manufacturing process.
Check Digit Verification of cas no
The CAS Registry Mumber 136605-16-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,6,0 and 5 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 136605-16:
(8*1)+(7*3)+(6*6)+(5*6)+(4*0)+(3*5)+(2*1)+(1*6)=118
118 % 10 = 8
So 136605-16-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H24N5O.BF4/c1-5-11-20(12-6-1)17(21-13-7-2-8-14-21)23-22-16-10-4-3-9-15(16)18-19-22;2-1(3,4)5/h3-4,9-10H,1-2,5-8,11-14H2;/q+1;-1