139458-30-3 Usage
Uses
Used in Organic Synthesis:
(3-METHYLISOXAZOL-4-YL)METHANAMINE is used as a building block in the synthesis of various organic compounds due to its unique structure and reactivity. Its presence in the molecule allows for the formation of new chemical bonds and the creation of diverse chemical entities.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, (3-METHYLISOXAZOL-4-YL)METHANAMINE is used as an intermediate in the synthesis of drugs. Its heterocyclic nature and functional groups make it a versatile component in the development of new pharmaceutical agents with potential therapeutic applications.
Used in Medicinal Chemistry:
(3-METHYLISOXAZOL-4-YL)METHANAMINE may have potential applications in medicinal chemistry, where it can be used to design and develop new drugs with specific biological activities. Its unique structure and functional groups can be exploited to target various biological pathways and diseases.
Used in Agricultural Chemistry:
In agricultural chemistry, (3-METHYLISOXAZOL-4-YL)METHANAMINE may be used in the development of agrochemicals, such as pesticides or herbicides. Its chemical properties can be utilized to create compounds that target specific pests or weeds, improving crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 139458-30-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,4,5 and 8 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 139458-30:
(8*1)+(7*3)+(6*9)+(5*4)+(4*5)+(3*8)+(2*3)+(1*0)=153
153 % 10 = 3
So 139458-30-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H8N2O/c1-4-5(2-6)3-8-7-4/h3H,2,6H2,1H3
