141946-28-3 Usage
Uses
Used in Medical Research:
1,7-Bis(9-acridinyl)heptane is used as a research compound for its potential antitumor activities. It is employed in various studies to explore its effectiveness in combating cancer cells and understanding its mechanism of action.
Used in Scientific Studies:
In the field of scientific research, 1,7-Bis(9-acridinyl)heptane serves as a valuable compound for investigating its chemical properties and interactions with biological systems. This can provide insights into its potential applications in drug development and other therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 141946-28-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,9,4 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 141946-28:
(8*1)+(7*4)+(6*1)+(5*9)+(4*4)+(3*6)+(2*2)+(1*8)=133
133 % 10 = 3
So 141946-28-3 is a valid CAS Registry Number.
InChI:InChI=1/C33H30N2/c1(2-4-14-24-26-16-6-10-20-30(26)34-31-21-11-7-17-27(24)31)3-5-15-25-28-18-8-12-22-32(28)35-33-23-13-9-19-29(25)33/h6-13,16-23H,1-5,14-15H2