142307-40-2 Usage
Uses
Used in Pharmaceutical Applications:
(5E)-3-ethyl-2-[(E)-(3-ethylbenzooxazol-2-ylidene)methyl]-5-(3-methylbenzothiazol-2-ylidene)-1-thia-3-azoniacyclopent-2-en-4-one acetate is used as a pharmaceutical agent for its potential therapeutic properties. (5E)-3-ethyl-2-[(E)-(3-ethylbenzooxazol-2-ylidene)methyl]-5-(3-methylb enzothiazol-2-ylidene)-1-thia-3-azoniacyclopent-2-en-4-one acetate's unique structure and functional groups may contribute to its ability to interact with biological targets and modulate various biological pathways, making it a promising candidate for the development of new drugs.
Used in Materials Science Applications:
In the field of materials science, (5E)-3-ethyl-2-[(E)-(3-ethylbenzooxazol-2-ylidene)methyl]-5-(3-methylbenzothiazol-2-ylidene)-1-thia-3-azoniacyclopent-2-en-4-one acetate is used for its potential to contribute to the development of new materials with unique properties. (5E)-3-ethyl-2-[(E)-(3-ethylbenzooxazol-2-ylidene)methyl]-5-(3-methylb enzothiazol-2-ylidene)-1-thia-3-azoniacyclopent-2-en-4-one acetate's structural features and functional groups may enable it to be incorporated into materials with specific characteristics, such as improved stability, enhanced reactivity, or novel optical, electronic, or mechanical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 142307-40-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,3,0 and 7 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 142307-40:
(8*1)+(7*4)+(6*2)+(5*3)+(4*0)+(3*7)+(2*4)+(1*0)=92
92 % 10 = 2
So 142307-40-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H22N3O2S2.C2H4O2/c1-4-25-15-10-6-8-12-17(15)28-19(25)14-20-26(5-2)22(27)21(30-20)23-24(3)16-11-7-9-13-18(16)29-23;1-2(3)4/h6-14H,4-5H2,1-3H3;1H3,(H,3,4)/q+1;/p-1/b23-21+;