14298-19-2 Usage
Uses
Used in Pharmaceutical Industry:
4H-Thieno[3,2-b]pyrrol-5(6H)-one is used as a core structure for the development of biologically active compounds, given its potential to be incorporated into more complex molecules with therapeutic applications. Its unique fused ring system allows for the creation of novel drug candidates with potential applications in various medical fields.
Used in Chemical Research:
4H-Thieno[3,2-b]pyrrol-5(6H)-one serves as a valuable starting material for researchers in the field of organic chemistry, particularly in the synthesis of new compounds with potential applications in various industries. Its distinctive structure makes it an interesting subject for studying the properties and reactivity of thienopyrrole-based compounds.
Used in Material Science:
4H-Thieno[3,2-b]pyrrol-5(6H)-one is used as a building block in the design and synthesis of advanced materials, such as organic semiconductors or optoelectronic devices. Its unique structure and potential for functionalization make it a promising candidate for the development of new materials with improved properties and performance.
Check Digit Verification of cas no
The CAS Registry Mumber 14298-19-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,2,9 and 8 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 14298-19:
(7*1)+(6*4)+(5*2)+(4*9)+(3*8)+(2*1)+(1*9)=112
112 % 10 = 2
So 14298-19-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H5NOS/c8-6-3-5-4(7-6)1-2-9-5/h1-2H,3H2,(H,7,8)
